C21H35N9O9 — CID 132553196
[1-azido-3-[2,2-bis[(2-acetyloxy-3-azidopropoxy)methyl]butoxy]propan-2-yl] acetate (PubChem CID 132553196) has the molecular formula C21H35N9O9 and a molecular weight of 557.57 g/mol. Its IUPAC name is [1-azido-3-[2,2-bis[(2-acetyloxy-3-azidopropoxy)methyl]butoxy]propan-2-yl] acetate.
| Compound Name | [1-azido-3-[2,2-bis[(2-acetyloxy-3-azidopropoxy)methyl]butoxy]propan-2-yl] acetate |
|---|---|
| PubChem CID | 132553196 |
| Molecular Formula | C21H35N9O9 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | [1-azido-3-[2,2-bis[(2-acetyloxy-3-azidopropoxy)methyl]butoxy]propan-2-yl] acetate |
| SMILES | CCC(COCC(CN=[N+]=[N-])OC(C)=O)(COCC(CN=[N+]=[N-])OC(C)=O)COCC(CN=[N+]=[N-])OC(C)=O |
| InChI | InChI=1S/C21H35N9O9/c1-5-21(12-34-9-18(6-25-28-22)37-15(2)31,13-35-10-19(7-26-29-23)38-16(3)32)14-36-11-20(8-27-30-24)39-17(4)33/h18-20H,5-14H2,1-4H3 |
| InChIKey | YRSRJCQIGGNZTH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 252.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|