C15H18FNO — CID 132553468
(1E,5R)-1-(dimethylamino)-5-(2-fluorophenyl)hepta-1,6-dien-3-one (PubChem CID 132553468) has the molecular formula C15H18FNO and a molecular weight of 247.31 g/mol. Its IUPAC name is (1E,5R)-1-(dimethylamino)-5-(2-fluorophenyl)hepta-1,6-dien-3-one.
| Compound Name | (1E,5R)-1-(dimethylamino)-5-(2-fluorophenyl)hepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 132553468 |
| Molecular Formula | C15H18FNO |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (1E,5R)-1-(dimethylamino)-5-(2-fluorophenyl)hepta-1,6-dien-3-one |
| SMILES | C=C[C@@H](CC(=O)/C=C/N(C)C)c1ccccc1F |
| InChI | InChI=1S/C15H18FNO/c1-4-12(11-13(18)9-10-17(2)3)14-7-5-6-8-15(14)16/h4-10,12H,1,11H2,2-3H3/b10-9+/t12-/m0/s1 |
| InChIKey | JAYYFNNHHNXAGO-VMPCVLLUSA-N |
| XLogP | 3.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|