C11H13FO — CID 134968528
(2S,3R)-3-(2-fluorophenyl)pent-4-en-2-ol (PubChem CID 134968528) has the molecular formula C11H13FO and a molecular weight of 180.22 g/mol. Its IUPAC name is (2S,3R)-3-(2-fluorophenyl)pent-4-en-2-ol.
| Compound Name | (2S,3R)-3-(2-fluorophenyl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 134968528 |
| Molecular Formula | C11H13FO |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (2S,3R)-3-(2-fluorophenyl)pent-4-en-2-ol |
| SMILES | C=C[C@H](c1ccccc1F)[C@H](C)O |
| InChI | InChI=1S/C11H13FO/c1-3-9(8(2)13)10-6-4-5-7-11(10)12/h3-9,13H,1H2,2H3/t8-,9-/m0/s1 |
| InChIKey | UOGVZNMKZYKCIW-IUCAKERBSA-N |
| XLogP | 2.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|