C30H44Br6O13 — CID 132555068
[2,2-bis[(2-bromo-2-methylpropanoyl)oxy]-3-[2,2,3-tris[(2-bromo-2-methylpropanoyl)oxy]propoxy]propyl] 2-bromo-2-methylpropanoate (PubChem CID 132555068) has the molecular formula C30H44Br6O13 and a molecular weight of 1092.09 g/mol. Its IUPAC name is [2,2-bis[(2-bromo-2-methylpropanoyl)oxy]-3-[2,2,3-tris[(2-bromo-2-methylpropanoyl)oxy]propoxy]propyl] 2-bromo-2-methylpropanoate.
| Compound Name | [2,2-bis[(2-bromo-2-methylpropanoyl)oxy]-3-[2,2,3-tris[(2-bromo-2-methylpropanoyl)oxy]propoxy]propyl] 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 132555068 |
| Molecular Formula | C30H44Br6O13 |
| Molecular Weight | 1092.09 g/mol |
| Exact Mass | 1085.79 |
| IUPAC Name | [2,2-bis[(2-bromo-2-methylpropanoyl)oxy]-3-[2,2,3-tris[(2-bromo-2-methylpropanoyl)oxy]propoxy]propyl] 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCC(COCC(COC(=O)C(C)(C)Br)(OC(=O)C(C)(C)Br)OC(=O)C(C)(C)Br)(OC(=O)C(C)(C)Br)OC(=O)C(C)(C)Br |
| InChI | InChI=1S/C30H44Br6O13/c1-23(2,31)17(37)44-15-29(46-19(39)25(5,6)33,47-20(40)26(7,8)34)13-43-14-30(48-21(41)27(9,10)35,49-22(42)28(11,12)36)16-45-18(38)24(3,4)32/h13-16H2,1-12H3 |
| InChIKey | MMENQQXCNWYAAJ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1092.09 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|