C32H54Br4O16 — CID 163421164
2-[[2,3-bis[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxy]-2-[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxymethyl]propoxy]methoxy]ethyl 2-bromo-2-methylpropanoate (PubChem CID 163421164) has the molecular formula C32H54Br4O16 and a molecular weight of 1014.38 g/mol. Its IUPAC name is 2-[[2,3-bis[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxy]-2-[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxymethyl]propoxy]methoxy]ethyl 2-bromo-2-methylpropanoate.
| Compound Name | 2-[[2,3-bis[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxy]-2-[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxymethyl]propoxy]methoxy]ethyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 163421164 |
| Molecular Formula | C32H54Br4O16 |
| Molecular Weight | 1014.38 g/mol |
| Exact Mass | 1010.01 |
| IUPAC Name | 2-[[2,3-bis[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxy]-2-[2-(2-bromo-2-methylpropanoyl)oxyethoxymethoxymethyl]propoxy]methoxy]ethyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCCOCOCC(COCOCCOC(=O)C(C)(C)Br)(COCOCCOC(=O)C(C)(C)Br)OCOCCOC(=O)C(C)(C)Br |
| InChI | InChI=1S/C32H54Br4O16/c1-28(2,33)24(37)48-13-9-41-20-45-17-32(52-23-44-12-16-51-27(40)31(7,8)36,18-46-21-42-10-14-49-25(38)29(3,4)34)19-47-22-43-11-15-50-26(39)30(5,6)35/h9-23H2,1-8H3 |
| InChIKey | AIOGBHRHQAHYNJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|