C29H19BF2N2 — CID 132555373
12,12-difluoro-10,14-diphenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4,6,8,10,14,16,18-nonaene (PubChem CID 132555373) has the molecular formula C29H19BF2N2 and a molecular weight of 444.29 g/mol. Its IUPAC name is 12,12-difluoro-10,14-diphenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4,6,8,10,14,16,18-nonaene.
| Compound Name | 12,12-difluoro-10,14-diphenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4,6,8,10,14,16,18-nonaene |
|---|---|
| PubChem CID | 132555373 |
| Molecular Formula | C29H19BF2N2 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 12,12-difluoro-10,14-diphenyl-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4,6,8,10,14,16,18-nonaene |
| SMILES | F[B-]1(F)n2c(c3ccccc3c2-c2ccccc2)C=C2c3ccccc3C(c3ccccc3)=[N+]21 |
| InChI | InChI=1S/C29H19BF2N2/c31-30(32)33-26(22-15-7-9-17-24(22)28(33)20-11-3-1-4-12-20)19-27-23-16-8-10-18-25(23)29(34(27)30)21-13-5-2-6-14-21/h1-19H |
| InChIKey | RLOZJZRFRJISPV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|