C44H42BF2NO4 — CID 132555377
4-[(Z)-3-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]phenyl]-1-difluoroboranyloxy-3-oxoprop-1-enyl]benzoic acid (PubChem CID 132555377) has the molecular formula C44H42BF2NO4 and a molecular weight of 697.63 g/mol. Its IUPAC name is 4-[(Z)-3-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]phenyl]-1-difluoroboranyloxy-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 4-[(Z)-3-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]phenyl]-1-difluoroboranyloxy-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 132555377 |
| Molecular Formula | C44H42BF2NO4 |
| Molecular Weight | 697.63 g/mol |
| Exact Mass | 697.32 |
| IUPAC Name | 4-[(Z)-3-[4-[(E)-2-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]ethenyl]phenyl]-1-difluoroboranyloxy-3-oxoprop-1-enyl]benzoic acid |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(/C=C/c3ccc(C(=O)/C=C(\OB(F)F)c4ccc(C(=O)O)cc4)cc3)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C44H42BF2NO4/c1-43(2,3)35-19-25-38(26-20-35)48(39-27-21-36(22-28-39)44(4,5)6)37-23-11-31(12-24-37)8-7-30-9-13-32(14-10-30)40(49)29-41(52-45(46)47)33-15-17-34(18-16-33)42(50)51/h7-29H,1-6H3,(H,50,51)/b8-7+,41-29- |
| InChIKey | FSDOTNLNCZUPCR-MKKXHMGISA-N |
| XLogP | 11.78 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.63 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|