C29H22BF2NO2 — CID 177498865
(2Z,4E)-3-difluoroboranyloxy-1-phenyl-5-[4-(N-phenylanilino)phenyl]penta-2,4-dien-1-one (PubChem CID 177498865) has the molecular formula C29H22BF2NO2 and a molecular weight of 465.31 g/mol. Its IUPAC name is (2Z,4E)-3-difluoroboranyloxy-1-phenyl-5-[4-(N-phenylanilino)phenyl]penta-2,4-dien-1-one.
| Compound Name | (2Z,4E)-3-difluoroboranyloxy-1-phenyl-5-[4-(N-phenylanilino)phenyl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 177498865 |
| Molecular Formula | C29H22BF2NO2 |
| Molecular Weight | 465.31 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (2Z,4E)-3-difluoroboranyloxy-1-phenyl-5-[4-(N-phenylanilino)phenyl]penta-2,4-dien-1-one |
| SMILES | O=C(/C=C(/C=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1)OB(F)F)c1ccccc1 |
| InChI | InChI=1S/C29H22BF2NO2/c31-30(32)35-28(22-29(34)24-10-4-1-5-11-24)21-18-23-16-19-27(20-17-23)33(25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-22H/b21-18+,28-22- |
| InChIKey | KMHOGQRCGMJVOT-POFGYXOESA-N |
| XLogP | 7.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.31 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|