C14H10N2O3S2 — CID 132560316
(3E)-3-[3-(4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]pyrrolidine-2,5-dione (PubChem CID 132560316) has the molecular formula C14H10N2O3S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (3E)-3-[3-(4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[3-(4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 132560316 |
| Molecular Formula | C14H10N2O3S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | (3E)-3-[3-(4-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)/C(=C3/CC(=O)NC3=O)SC2=S)cc1 |
| InChI | InChI=1S/C14H10N2O3S2/c1-7-2-4-8(5-3-7)16-13(19)11(21-14(16)20)9-6-10(17)15-12(9)18/h2-5H,6H2,1H3,(H,15,17,18)/b11-9+ |
| InChIKey | MAOHHZHGFZJDTJ-PKNBQFBNSA-N |
| XLogP | 1.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|