C12H17NO — CID 132561521
4-(1-methoxy-2,3-dimethylbut-2-enyl)pyridine (PubChem CID 132561521) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-(1-methoxy-2,3-dimethylbut-2-enyl)pyridine.
| Compound Name | 4-(1-methoxy-2,3-dimethylbut-2-enyl)pyridine |
|---|---|
| PubChem CID | 132561521 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-(1-methoxy-2,3-dimethylbut-2-enyl)pyridine |
| SMILES | COC(C(C)=C(C)C)c1ccncc1 |
| InChI | InChI=1S/C12H17NO/c1-9(2)10(3)12(14-4)11-5-7-13-8-6-11/h5-8,12H,1-4H3 |
| InChIKey | BMVQUDBBOCNYNJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|