C12H10FN3O4 — CID 132562020
6-fluoro-8-nitro-2-pyrrolidin-1-yl-1,3-benzoxazin-4-one (PubChem CID 132562020) has the molecular formula C12H10FN3O4 and a molecular weight of 279.23 g/mol. Its IUPAC name is 6-fluoro-8-nitro-2-pyrrolidin-1-yl-1,3-benzoxazin-4-one.
| Compound Name | 6-fluoro-8-nitro-2-pyrrolidin-1-yl-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 132562020 |
| Molecular Formula | C12H10FN3O4 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 6-fluoro-8-nitro-2-pyrrolidin-1-yl-1,3-benzoxazin-4-one |
| SMILES | O=c1nc(N2CCCC2)oc2c([N+](=O)[O-])cc(F)cc12 |
| InChI | InChI=1S/C12H10FN3O4/c13-7-5-8-10(9(6-7)16(18)19)20-12(14-11(8)17)15-3-1-2-4-15/h5-6H,1-4H2 |
| InChIKey | BZQFUKFPASBZDI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|