C20H32O3Si — CID 132564592
[2-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-[(E)-1-trimethylsilylprop-1-en-2-yl]cyclopropyl]methanol (PubChem CID 132564592) has the molecular formula C20H32O3Si and a molecular weight of 348.56 g/mol. Its IUPAC name is [2-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-[(E)-1-trimethylsilylprop-1-en-2-yl]cyclopropyl]methanol.
| Compound Name | [2-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-[(E)-1-trimethylsilylprop-1-en-2-yl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 132564592 |
| Molecular Formula | C20H32O3Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [2-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-[(E)-1-trimethylsilylprop-1-en-2-yl]cyclopropyl]methanol |
| SMILES | COc1ccc(COCCC2(/C(C)=C/[Si](C)(C)C)CC2CO)cc1 |
| InChI | InChI=1S/C20H32O3Si/c1-16(15-24(3,4)5)20(12-18(20)13-21)10-11-23-14-17-6-8-19(22-2)9-7-17/h6-9,15,18,21H,10-14H2,1-5H3/b16-15+ |
| InChIKey | QEFOCJGHLUGTTD-FOCLMDBBSA-N |
| XLogP | 4.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|