C33H35N3O5 — CID 132565252
9-[4-[[1-(2-methoxyphenyl)triazol-4-yl]methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 132565252) has the molecular formula C33H35N3O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is 9-[4-[[1-(2-methoxyphenyl)triazol-4-yl]methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[4-[[1-(2-methoxyphenyl)triazol-4-yl]methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 132565252 |
| Molecular Formula | C33H35N3O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 9-[4-[[1-(2-methoxyphenyl)triazol-4-yl]methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | COc1ccccc1-n1cc(COc2ccc(C3C4=C(CC(C)(C)CC4=O)OC4=C3C(=O)CC(C)(C)C4)cc2)nn1 |
| InChI | InChI=1S/C33H35N3O5/c1-32(2)14-24(37)30-27(16-32)41-28-17-33(3,4)15-25(38)31(28)29(30)20-10-12-22(13-11-20)40-19-21-18-36(35-34-21)23-8-6-7-9-26(23)39-5/h6-13,18,29H,14-17,19H2,1-5H3 |
| InChIKey | TWFXTNLTPZLJDL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |