C35H39N3O7 — CID 132565261
9-[3,5-dimethoxy-4-[[1-(2-methoxyphenyl)triazol-4-yl]methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 132565261) has the molecular formula C35H39N3O7 and a molecular weight of 613.71 g/mol. Its IUPAC name is 9-[3,5-dimethoxy-4-[[1-(2-methoxyphenyl)triazol-4-yl]methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-[3,5-dimethoxy-4-[[1-(2-methoxyphenyl)triazol-4-yl]methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 132565261 |
| Molecular Formula | C35H39N3O7 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | 9-[3,5-dimethoxy-4-[[1-(2-methoxyphenyl)triazol-4-yl]methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | COc1ccccc1-n1cc(COc2c(OC)cc(C3C4=C(CC(C)(C)CC4=O)OC4=C3C(=O)CC(C)(C)C4)cc2OC)nn1 |
| InChI | InChI=1S/C35H39N3O7/c1-34(2)14-23(39)31-28(16-34)45-29-17-35(3,4)15-24(40)32(29)30(31)20-12-26(42-6)33(27(13-20)43-7)44-19-21-18-38(37-36-21)22-10-8-9-11-25(22)41-5/h8-13,18,30H,14-17,19H2,1-7H3 |
| InChIKey | WBEYUGXEKTXDAZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |