C16H21NO3 — CID 132566577
(3aS,4R,6aS)-4-hydroxy-N-[(1S)-1-phenylethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-6-carboxamide (PubChem CID 132566577) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (3aS,4R,6aS)-4-hydroxy-N-[(1S)-1-phenylethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-6-carboxamide.
| Compound Name | (3aS,4R,6aS)-4-hydroxy-N-[(1S)-1-phenylethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-6-carboxamide |
|---|---|
| PubChem CID | 132566577 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (3aS,4R,6aS)-4-hydroxy-N-[(1S)-1-phenylethyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-6-carboxamide |
| SMILES | C[C@H](NC(=O)C1C[C@@H](O)[C@@H]2COC[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-10(11-5-3-2-4-6-11)17-16(19)12-7-15(18)14-9-20-8-13(12)14/h2-6,10,12-15,18H,7-9H2,1H3,(H,17,19)/t10-,12?,13+,14+,15+/m0/s1 |
| InChIKey | WARIAMWSFVDPSO-MHVKIQEISA-N |
| XLogP | 1.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |