C28H40O7S3 — CID 132568180
2-[2-[5-[2-(2-methoxyethoxy)ethoxy]naphthalen-1-yl]oxyethoxy]ethyl 2-methyl-2-(2-methylpropylsulfanylcarbothioylsulfanyl)propanoate (PubChem CID 132568180) has the molecular formula C28H40O7S3 and a molecular weight of 584.82 g/mol. Its IUPAC name is 2-[2-[5-[2-(2-methoxyethoxy)ethoxy]naphthalen-1-yl]oxyethoxy]ethyl 2-methyl-2-(2-methylpropylsulfanylcarbothioylsulfanyl)propanoate.
| Compound Name | 2-[2-[5-[2-(2-methoxyethoxy)ethoxy]naphthalen-1-yl]oxyethoxy]ethyl 2-methyl-2-(2-methylpropylsulfanylcarbothioylsulfanyl)propanoate |
|---|---|
| PubChem CID | 132568180 |
| Molecular Formula | C28H40O7S3 |
| Molecular Weight | 584.82 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 2-[2-[5-[2-(2-methoxyethoxy)ethoxy]naphthalen-1-yl]oxyethoxy]ethyl 2-methyl-2-(2-methylpropylsulfanylcarbothioylsulfanyl)propanoate |
| SMILES | COCCOCCOc1cccc2c(OCCOCCOC(=O)C(C)(C)SC(=S)SCC(C)C)cccc12 |
| InChI | InChI=1S/C28H40O7S3/c1-21(2)20-37-27(36)38-28(3,4)26(29)35-19-16-32-15-18-34-25-11-7-8-22-23(25)9-6-10-24(22)33-17-14-31-13-12-30-5/h6-11,21H,12-20H2,1-5H3 |
| InChIKey | JPEVSCNPWHRVTK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.82 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|