C29H30O4 — CID 132568518
tert-butyl (2R)-5-methyl-3-oxo-2-[(4R)-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl]-1H-indene-2-carboxylate (PubChem CID 132568518) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is tert-butyl (2R)-5-methyl-3-oxo-2-[(4R)-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl]-1H-indene-2-carboxylate.
| Compound Name | tert-butyl (2R)-5-methyl-3-oxo-2-[(4R)-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl]-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 132568518 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | tert-butyl (2R)-5-methyl-3-oxo-2-[(4R)-2-phenyl-4,5,6,7-tetrahydro-1-benzofuran-4-yl]-1H-indene-2-carboxylate |
| SMILES | Cc1ccc2c(c1)C(=O)[C@](C(=O)OC(C)(C)C)([C@@H]1CCCc3oc(-c4ccccc4)cc31)C2 |
| InChI | InChI=1S/C29H30O4/c1-18-13-14-20-17-29(26(30)21(20)15-18,27(31)33-28(2,3)4)23-11-8-12-24-22(23)16-25(32-24)19-9-6-5-7-10-19/h5-7,9-10,13-16,23H,8,11-12,17H2,1-4H3/t23-,29-/m1/s1 |
| InChIKey | IWKLSLGYQYUQNP-RNWIMVQKSA-N |
| XLogP | 6.44 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|