C25H16O4 — CID 132568688
2-[2-(4-methoxyphenyl)chromen-4-ylidene]indene-1,3-dione (PubChem CID 132568688) has the molecular formula C25H16O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)chromen-4-ylidene]indene-1,3-dione.
| Compound Name | 2-[2-(4-methoxyphenyl)chromen-4-ylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 132568688 |
| Molecular Formula | C25H16O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)chromen-4-ylidene]indene-1,3-dione |
| SMILES | COc1ccc(C2=CC(=C3C(=O)c4ccccc4C3=O)c3ccccc3O2)cc1 |
| InChI | InChI=1S/C25H16O4/c1-28-16-12-10-15(11-13-16)22-14-20(17-6-4-5-9-21(17)29-22)23-24(26)18-7-2-3-8-19(18)25(23)27/h2-14H,1H3 |
| InChIKey | YRMMDDIZHWGUCH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|