C16H12F5NO3S — CID 132570165
methyl 3-oxo-2-[6-(pentafluoro-λ6-sulfanyl)-3-pyridinyl]-1H-indene-2-carboxylate (PubChem CID 132570165) has the molecular formula C16H12F5NO3S and a molecular weight of 393.33 g/mol. Its IUPAC name is methyl 3-oxo-2-[6-(pentafluoro-λ6-sulfanyl)-3-pyridinyl]-1H-indene-2-carboxylate.
| Compound Name | methyl 3-oxo-2-[6-(pentafluoro-λ6-sulfanyl)-3-pyridinyl]-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 132570165 |
| Molecular Formula | C16H12F5NO3S |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | methyl 3-oxo-2-[6-(pentafluoro-λ6-sulfanyl)-3-pyridinyl]-1H-indene-2-carboxylate |
| SMILES | COC(=O)C1(c2ccc(S(F)(F)(F)(F)F)nc2)Cc2ccccc2C1=O |
| InChI | InChI=1S/C16H12F5NO3S/c1-25-15(24)16(8-10-4-2-3-5-12(10)14(16)23)11-6-7-13(22-9-11)26(17,18,19,20)21/h2-7,9H,8H2,1H3 |
| InChIKey | WPRBVDDPAZFUNA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|