C16H22N2 — CID 132571343
5-[1-(1-benzylaziridin-2-yl)propan-2-yl]-3,4-dihydro-2H-pyrrole (PubChem CID 132571343) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 5-[1-(1-benzylaziridin-2-yl)propan-2-yl]-3,4-dihydro-2H-pyrrole.
| Compound Name | 5-[1-(1-benzylaziridin-2-yl)propan-2-yl]-3,4-dihydro-2H-pyrrole |
|---|---|
| PubChem CID | 132571343 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 5-[1-(1-benzylaziridin-2-yl)propan-2-yl]-3,4-dihydro-2H-pyrrole |
| SMILES | CC(CC1CN1Cc1ccccc1)C1=NCCC1 |
| InChI | InChI=1S/C16H22N2/c1-13(16-8-5-9-17-16)10-15-12-18(15)11-14-6-3-2-4-7-14/h2-4,6-7,13,15H,5,8-12H2,1H3 |
| InChIKey | OUJDBPTXSXEUMR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|