C14H16N4O — CID 132571786
2-(azidomethyl)-4,4-dimethyl-5-oxo-5-phenylpentanenitrile (PubChem CID 132571786) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(azidomethyl)-4,4-dimethyl-5-oxo-5-phenylpentanenitrile.
| Compound Name | 2-(azidomethyl)-4,4-dimethyl-5-oxo-5-phenylpentanenitrile |
|---|---|
| PubChem CID | 132571786 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-(azidomethyl)-4,4-dimethyl-5-oxo-5-phenylpentanenitrile |
| SMILES | CC(C)(CC(C#N)CN=[N+]=[N-])C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16N4O/c1-14(2,8-11(9-15)10-17-18-16)13(19)12-6-4-3-5-7-12/h3-7,11H,8,10H2,1-2H3 |
| InChIKey | DHEWXJJQQGKKNA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 89.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|