C13H15N3O3 — CID 11207708
6-azido-5-methoxy-1-phenylhexane-1,3-dione (PubChem CID 11207708) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 6-azido-5-methoxy-1-phenylhexane-1,3-dione.
| Compound Name | 6-azido-5-methoxy-1-phenylhexane-1,3-dione |
|---|---|
| PubChem CID | 11207708 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 6-azido-5-methoxy-1-phenylhexane-1,3-dione |
| SMILES | COC(CN=[N+]=[N-])CC(=O)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15N3O3/c1-19-12(9-15-16-14)7-11(17)8-13(18)10-5-3-2-4-6-10/h2-6,12H,7-9H2,1H3 |
| InChIKey | NEAQKRDRUVOKTJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|