C35H13BF20N9OP — CID 139734262
tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(azidomethyl)-phenacylphosphanium (PubChem CID 139734262) has the molecular formula C35H13BF20N9OP and a molecular weight of 997.30 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(azidomethyl)-phenacylphosphanium.
| Compound Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(azidomethyl)-phenacylphosphanium |
|---|---|
| PubChem CID | 139734262 |
| Molecular Formula | C35H13BF20N9OP |
| Molecular Weight | 997.30 g/mol |
| Exact Mass | 997.08 |
| IUPAC Name | tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide;tris(azidomethyl)-phenacylphosphanium |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.[N-]=[N+]=NC[P+](CN=[N+]=[N-])(CN=[N+]=[N-])CC(=O)c1ccccc1 |
| InChI | InChI=1S/C24BF20.C11H13N9OP/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;12-18-15-7-22(8-16-19-13,9-17-20-14)6-11(21)10-4-2-1-3-5-10/h;1-5H,6-9H2/q-1;+1 |
| InChIKey | ULAZNWKJONWAEQ-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 163.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.30 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|