About 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate
1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate (PubChem CID 135209704) has the molecular formula C18H30N4O6
and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate.
Molecular Properties
| Compound Name | 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate |
| PubChem CID | 135209704 |
| Molecular Formula | C18H30N4O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate |
| SMILES | CCC(CC(C#N)CC(C)(C)C(=O)OCC(O)CN=[N+]=[N-])C(=O)OCCOC |
| InChI | InChI=1S/C18H30N4O6/c1-5-14(16(24)27-7-6-26-4)8-13(10-19)9-18(2,3)17(25)28-12-15(23)11-21-22-20/h13-15,23H,5-9,11-12H2,1-4H3 |
| InChIKey | SGNVYOFCEPAFNB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate?
The IUPAC name of 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate (CID 135209704) is 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate.
What is the SMILES notation for 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate?
The canonical SMILES for 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate is CCC(CC(C#N)CC(C)(C)C(=O)OCC(O)CN=[N+]=[N-])C(=O)OCCOC.
What is the InChIKey of 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate?
The InChIKey is SGNVYOFCEPAFNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N4O6/c1-5-14(16(24)27-7-6-26-4)8-13(10-19)9-18(2,3)17(25)28-12-15(23)11-21-22-20/h13-15,23H,5-9,11-12H2,1-4H3.
What are the key properties of 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate?
1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate has a molecular weight of 398.46 g/mol, XLogP of 2.36, 14 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(3-azido-2-hydroxypropyl) 7-O-(2-methoxyethyl) 4-cyano-6-ethyl-2,2-dimethylheptanedioate is sourced from PubChem (CID 135209704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).