About (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane
(2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane (PubChem CID 132574437) has the molecular formula C33H24NPS
and a molecular weight of 497.60 g/mol. Its IUPAC name is (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane |
| PubChem CID | 132574437 |
| Molecular Formula | C33H24NPS |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane |
| SMILES | S=P(c1ccccc1)(c1ccccc1)c1cccc2c(-c3ccccc3)cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C33H24NPS/c36-35(27-18-9-3-10-19-27,28-20-11-4-12-21-28)32-23-13-22-29-30(25-14-5-1-6-15-25)24-31(34-33(29)32)26-16-7-2-8-17-26/h1-24H |
| InChIKey | KWCGADAYOHYYAS-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane?
The IUPAC name of (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane (CID 132574437) is (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane.
What is the SMILES notation for (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane?
The canonical SMILES for (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane is S=P(c1ccccc1)(c1ccccc1)c1cccc2c(-c3ccccc3)cc(-c3ccccc3)nc12.
What is the InChIKey of (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane?
The InChIKey is KWCGADAYOHYYAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H24NPS/c36-35(27-18-9-3-10-19-27,28-20-11-4-12-21-28)32-23-13-22-29-30(25-14-5-1-6-15-25)24-31(34-33(29)32)26-16-7-2-8-17-26/h1-24H.
What are the key properties of (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane?
(2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane has a molecular weight of 497.60 g/mol, XLogP of 7.32, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-diphenylquinolin-8-yl)-diphenyl-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 132574437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).