C15H20O3 — CID 132574863
(1R,2S,6R,8R,11R)-6-methyl-5-methylidene-11-propan-2-yl-9-oxatricyclo[6.2.1.02,6]undecane-4,10-dione (PubChem CID 132574863) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1R,2S,6R,8R,11R)-6-methyl-5-methylidene-11-propan-2-yl-9-oxatricyclo[6.2.1.02,6]undecane-4,10-dione.
| Compound Name | (1R,2S,6R,8R,11R)-6-methyl-5-methylidene-11-propan-2-yl-9-oxatricyclo[6.2.1.02,6]undecane-4,10-dione |
|---|---|
| PubChem CID | 132574863 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1R,2S,6R,8R,11R)-6-methyl-5-methylidene-11-propan-2-yl-9-oxatricyclo[6.2.1.02,6]undecane-4,10-dione |
| SMILES | C=C1C(=O)C[C@H]2[C@H]3C(=O)O[C@H](C[C@@]12C)[C@@H]3C(C)C |
| InChI | InChI=1S/C15H20O3/c1-7(2)12-11-6-15(4)8(3)10(16)5-9(15)13(12)14(17)18-11/h7,9,11-13H,3,5-6H2,1-2,4H3/t9-,11+,12-,13+,15-/m0/s1 |
| InChIKey | BXMXLDBFJGKEFX-IYBIKKAESA-N |
| XLogP | 2.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|