C13H18O2 — CID 135041010
(4R,7S)-1,2-dimethyl-9-methylidene-5-oxatricyclo[5.2.2.04,8]undecan-6-one (PubChem CID 135041010) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (4R,7S)-1,2-dimethyl-9-methylidene-5-oxatricyclo[5.2.2.04,8]undecan-6-one.
| Compound Name | (4R,7S)-1,2-dimethyl-9-methylidene-5-oxatricyclo[5.2.2.04,8]undecan-6-one |
|---|---|
| PubChem CID | 135041010 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (4R,7S)-1,2-dimethyl-9-methylidene-5-oxatricyclo[5.2.2.04,8]undecan-6-one |
| SMILES | C=C1C2[C@@H]3CCC1(C)C(C)C[C@H]2OC3=O |
| InChI | InChI=1S/C13H18O2/c1-7-6-10-11-8(2)13(7,3)5-4-9(11)12(14)15-10/h7,9-11H,2,4-6H2,1,3H3/t7?,9-,10+,11?,13?/m0/s1 |
| InChIKey | OOZWPBBSWQJQIU-PYIWNATQSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|