C13H20O2 — CID 135041001
(4R,6S,7S)-1,2-dimethyl-9-methylidene-5-oxatricyclo[5.2.2.04,8]undecan-6-ol (PubChem CID 135041001) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (4R,6S,7S)-1,2-dimethyl-9-methylidene-5-oxatricyclo[5.2.2.04,8]undecan-6-ol.
| Compound Name | (4R,6S,7S)-1,2-dimethyl-9-methylidene-5-oxatricyclo[5.2.2.04,8]undecan-6-ol |
|---|---|
| PubChem CID | 135041001 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (4R,6S,7S)-1,2-dimethyl-9-methylidene-5-oxatricyclo[5.2.2.04,8]undecan-6-ol |
| SMILES | C=C1C2[C@H]3CC(C)C1(C)CC[C@@H]2[C@@H](O)O3 |
| InChI | InChI=1S/C13H20O2/c1-7-6-10-11-8(2)13(7,3)5-4-9(11)12(14)15-10/h7,9-12,14H,2,4-6H2,1,3H3/t7?,9-,10+,11?,12-,13?/m0/s1 |
| InChIKey | IIYAGDRHPXJRCM-LCIABPCHSA-N |
| XLogP | 2.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|