C15H22O4 — CID 51042634
(1R,3aR,5S,5aR,8S,8aR,8bR)-1,3a,8-trihydroxy-5,8-dimethyl-2-methylidene-1,4,5,5a,6,7,8a,8b-octahydroacenaphthylen-3-one (PubChem CID 51042634) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,3aR,5S,5aR,8S,8aR,8bR)-1,3a,8-trihydroxy-5,8-dimethyl-2-methylidene-1,4,5,5a,6,7,8a,8b-octahydroacenaphthylen-3-one.
| Compound Name | (1R,3aR,5S,5aR,8S,8aR,8bR)-1,3a,8-trihydroxy-5,8-dimethyl-2-methylidene-1,4,5,5a,6,7,8a,8b-octahydroacenaphthylen-3-one |
|---|---|
| PubChem CID | 51042634 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1R,3aR,5S,5aR,8S,8aR,8bR)-1,3a,8-trihydroxy-5,8-dimethyl-2-methylidene-1,4,5,5a,6,7,8a,8b-octahydroacenaphthylen-3-one |
| SMILES | C=C1[C@H](O)[C@H]2[C@H]3[C@H](CC[C@]2(C)O)[C@@H](C)CC(=O)[C@]13O |
| InChI | InChI=1S/C15H22O4/c1-7-6-10(16)15(19)8(2)13(17)12-11(15)9(7)4-5-14(12,3)18/h7,9,11-13,17-19H,2,4-6H2,1,3H3/t7-,9+,11+,12+,13-,14-,15+/m0/s1 |
| InChIKey | BFXFXSHNWPYPKE-YDOSKQRASA-N |
| XLogP | 0.65 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|