C17H30O2 — CID 142000430
1,3,7,7-tetramethyl-1,3,3a,4,4a,5,6,8,9,9a,10,10a-dodecahydrocyclohepta[f][2]benzofuran-4-ol (PubChem CID 142000430) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 1,3,7,7-tetramethyl-1,3,3a,4,4a,5,6,8,9,9a,10,10a-dodecahydrocyclohepta[f][2]benzofuran-4-ol.
| Compound Name | 1,3,7,7-tetramethyl-1,3,3a,4,4a,5,6,8,9,9a,10,10a-dodecahydrocyclohepta[f][2]benzofuran-4-ol |
|---|---|
| PubChem CID | 142000430 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 1,3,7,7-tetramethyl-1,3,3a,4,4a,5,6,8,9,9a,10,10a-dodecahydrocyclohepta[f][2]benzofuran-4-ol |
| SMILES | CC1OC(C)C2C(O)C3CCC(C)(C)CCC3CC12 |
| InChI | InChI=1S/C17H30O2/c1-10-14-9-12-5-7-17(3,4)8-6-13(12)16(18)15(14)11(2)19-10/h10-16,18H,5-9H2,1-4H3 |
| InChIKey | DNSMJJJQDIFZDD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |