C17H28O2 — CID 142000458
1,3,7,7-tetramethyl-3,3a,4a,5,6,8,9,9a,10,10a-decahydro-1H-cyclohepta[f][2]benzofuran-4-one (PubChem CID 142000458) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 1,3,7,7-tetramethyl-3,3a,4a,5,6,8,9,9a,10,10a-decahydro-1H-cyclohepta[f][2]benzofuran-4-one.
| Compound Name | 1,3,7,7-tetramethyl-3,3a,4a,5,6,8,9,9a,10,10a-decahydro-1H-cyclohepta[f][2]benzofuran-4-one |
|---|---|
| PubChem CID | 142000458 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1,3,7,7-tetramethyl-3,3a,4a,5,6,8,9,9a,10,10a-decahydro-1H-cyclohepta[f][2]benzofuran-4-one |
| SMILES | CC1OC(C)C2C(=O)C3CCC(C)(C)CCC3CC12 |
| InChI | InChI=1S/C17H28O2/c1-10-14-9-12-5-7-17(3,4)8-6-13(12)16(18)15(14)11(2)19-10/h10-15H,5-9H2,1-4H3 |
| InChIKey | OSPKIDFEWNZCCN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |