C29H46O5 — CID 159619787
1-methoxy-3-methyl-3,3a,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-4-one;1-methoxy-3-methyl-4-methylidene-3,3a,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran (PubChem CID 159619787) has the molecular formula C29H46O5 and a molecular weight of 474.68 g/mol. Its IUPAC name is 1-methoxy-3-methyl-3,3a,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-4-one;1-methoxy-3-methyl-4-methylidene-3,3a,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran.
| Compound Name | 1-methoxy-3-methyl-3,3a,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-4-one;1-methoxy-3-methyl-4-methylidene-3,3a,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran |
|---|---|
| PubChem CID | 159619787 |
| Molecular Formula | C29H46O5 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | 1-methoxy-3-methyl-3,3a,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-4-one;1-methoxy-3-methyl-4-methylidene-3,3a,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran |
| SMILES | C=C1C2CCCCC2CC2C(OC)OC(C)C12.COC1OC(C)C2C(=O)C3CCCCC3CC12 |
| InChI | InChI=1S/C15H24O2.C14H22O3/c1-9-12-7-5-4-6-11(12)8-13-14(9)10(2)17-15(13)16-3;1-8-12-11(14(16-2)17-8)7-9-5-3-4-6-10(9)13(12)15/h10-15H,1,4-8H2,2-3H3;8-12,14H,3-7H2,1-2H3 |
| InChIKey | MNTAJMBNGBATQU-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|