C16H28O5S — CID 101220377
[(1S,3S,3aR,4R,4aS,8aR,9aS)-1-methoxy-3-methyl-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran-4-yl]methyl methanesulfonate (PubChem CID 101220377) has the molecular formula C16H28O5S and a molecular weight of 332.46 g/mol. Its IUPAC name is [(1S,3S,3aR,4R,4aS,8aR,9aS)-1-methoxy-3-methyl-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran-4-yl]methyl methanesulfonate.
| Compound Name | [(1S,3S,3aR,4R,4aS,8aR,9aS)-1-methoxy-3-methyl-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 101220377 |
| Molecular Formula | C16H28O5S |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [(1S,3S,3aR,4R,4aS,8aR,9aS)-1-methoxy-3-methyl-1,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydrobenzo[f][2]benzofuran-4-yl]methyl methanesulfonate |
| SMILES | CO[C@H]1O[C@@H](C)[C@H]2[C@@H]1C[C@H]1CCCC[C@@H]1[C@H]2COS(C)(=O)=O |
| InChI | InChI=1S/C16H28O5S/c1-10-15-13(16(19-2)21-10)8-11-6-4-5-7-12(11)14(15)9-20-22(3,17)18/h10-16H,4-9H2,1-3H3/t10-,11+,12-,13-,14+,15-,16-/m0/s1 |
| InChIKey | NNFLNLFKFAWTIQ-ISFQMUQJSA-N |
| XLogP | 2.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|