C33H33N3 — CID 132575234
4,6-bis(4-tert-butylphenyl)-1,3,5-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-2,4,6,8,10,12,14-heptaene (PubChem CID 132575234) has the molecular formula C33H33N3 and a molecular weight of 471.65 g/mol. Its IUPAC name is 4,6-bis(4-tert-butylphenyl)-1,3,5-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-2,4,6,8,10,12,14-heptaene.
| Compound Name | 4,6-bis(4-tert-butylphenyl)-1,3,5-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-2,4,6,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 132575234 |
| Molecular Formula | C33H33N3 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 4,6-bis(4-tert-butylphenyl)-1,3,5-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-2,4,6,8,10,12,14-heptaene |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)c3cc4n(c3n2)Cc2ccccc2-4)cc1 |
| InChI | InChI=1S/C33H33N3/c1-32(2,3)24-15-11-21(12-16-24)29-27-19-28-26-10-8-7-9-23(26)20-36(28)31(27)35-30(34-29)22-13-17-25(18-14-22)33(4,5)6/h7-19H,20H2,1-6H3 |
| InChIKey | ARQYHJMSLBFTEX-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |