C21H19NO2 — CID 132576824
(4R)-6-benzyl-3-methyl-4-phenyl-4,5-dihydropyrano[2,3-c]pyrrol-7-one (PubChem CID 132576824) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (4R)-6-benzyl-3-methyl-4-phenyl-4,5-dihydropyrano[2,3-c]pyrrol-7-one.
| Compound Name | (4R)-6-benzyl-3-methyl-4-phenyl-4,5-dihydropyrano[2,3-c]pyrrol-7-one |
|---|---|
| PubChem CID | 132576824 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (4R)-6-benzyl-3-methyl-4-phenyl-4,5-dihydropyrano[2,3-c]pyrrol-7-one |
| SMILES | CC1=COC2=C(CN(Cc3ccccc3)C2=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H19NO2/c1-15-14-24-20-18(19(15)17-10-6-3-7-11-17)13-22(21(20)23)12-16-8-4-2-5-9-16/h2-11,14,19H,12-13H2,1H3/t19-/m0/s1 |
| InChIKey | ZBZGOPHEEMJXTC-IBGZPJMESA-N |
| XLogP | 4.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |