C27H24BrNO3 — CID 134961039
(2R,3R,4R)-3,6-dibenzyl-3-bromo-2-hydroxy-4-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrrol-7-one (PubChem CID 134961039) has the molecular formula C27H24BrNO3 and a molecular weight of 490.40 g/mol. Its IUPAC name is (2R,3R,4R)-3,6-dibenzyl-3-bromo-2-hydroxy-4-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrrol-7-one.
| Compound Name | (2R,3R,4R)-3,6-dibenzyl-3-bromo-2-hydroxy-4-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrrol-7-one |
|---|---|
| PubChem CID | 134961039 |
| Molecular Formula | C27H24BrNO3 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (2R,3R,4R)-3,6-dibenzyl-3-bromo-2-hydroxy-4-phenyl-4,5-dihydro-2H-pyrano[2,3-c]pyrrol-7-one |
| SMILES | O=C1C2=C(CN1Cc1ccccc1)[C@@H](c1ccccc1)[C@](Br)(Cc1ccccc1)[C@H](O)O2 |
| InChI | InChI=1S/C27H24BrNO3/c28-27(16-19-10-4-1-5-11-19)23(21-14-8-3-9-15-21)22-18-29(17-20-12-6-2-7-13-20)25(30)24(22)32-26(27)31/h1-15,23,26,31H,16-18H2/t23-,26-,27-/m1/s1 |
| InChIKey | JYXQHJDJGGABOA-XSBVVTFOSA-N |
| XLogP | 4.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|