C19H20N2O2 — CID 132576889
benzyl (4S,5R)-4,5-dimethyl-4-phenyl-1H-imidazole-5-carboxylate (PubChem CID 132576889) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is benzyl (4S,5R)-4,5-dimethyl-4-phenyl-1H-imidazole-5-carboxylate.
| Compound Name | benzyl (4S,5R)-4,5-dimethyl-4-phenyl-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 132576889 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | benzyl (4S,5R)-4,5-dimethyl-4-phenyl-1H-imidazole-5-carboxylate |
| SMILES | C[C@@]1(C(=O)OCc2ccccc2)NC=N[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O2/c1-18(16-11-7-4-8-12-16)19(2,21-14-20-18)17(22)23-13-15-9-5-3-6-10-15/h3-12,14H,13H2,1-2H3,(H,20,21)/t18-,19-/m0/s1 |
| InChIKey | BSJLVWMFVIPDQK-OALUTQOASA-N |
| XLogP | 3.04 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |