C22H28OSi — CID 132577183
CID 132577183 (PubChem CID 132577183) has the molecular formula C22H28OSi and a molecular weight of 336.55 g/mol.
| Compound Name | CID 132577183 |
|---|---|
| PubChem CID | 132577183 |
| Molecular Formula | C22H28OSi |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | — |
| SMILES | [C]=C(C(C)(C)C)[Si](OC(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28OSi/c1-18(21(2,3)4)24(23-22(5,6)7,19-14-10-8-11-15-19)20-16-12-9-13-17-20/h8-17H,2-7H3 |
| InChIKey | NQUOYVASGOXAPX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|