C24H44N10O4 — CID 132577374
(2S)-2-(4-azidobutanoylamino)-N-[6-[[(2S)-2-(4-azidobutanoylamino)-3-methylbutanoyl]amino]hexyl]-3-methylbutanamide (PubChem CID 132577374) has the molecular formula C24H44N10O4 and a molecular weight of 536.68 g/mol. Its IUPAC name is (2S)-2-(4-azidobutanoylamino)-N-[6-[[(2S)-2-(4-azidobutanoylamino)-3-methylbutanoyl]amino]hexyl]-3-methylbutanamide.
| Compound Name | (2S)-2-(4-azidobutanoylamino)-N-[6-[[(2S)-2-(4-azidobutanoylamino)-3-methylbutanoyl]amino]hexyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 132577374 |
| Molecular Formula | C24H44N10O4 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | (2S)-2-(4-azidobutanoylamino)-N-[6-[[(2S)-2-(4-azidobutanoylamino)-3-methylbutanoyl]amino]hexyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)CCCN=[N+]=[N-])C(=O)NCCCCCCNC(=O)[C@@H](NC(=O)CCCN=[N+]=[N-])C(C)C |
| InChI | InChI=1S/C24H44N10O4/c1-17(2)21(31-19(35)11-9-15-29-33-25)23(37)27-13-7-5-6-8-14-28-24(38)22(18(3)4)32-20(36)12-10-16-30-34-26/h17-18,21-22H,5-16H2,1-4H3,(H,27,37)(H,28,38)(H,31,35)(H,32,36)/t21-,22-/m0/s1 |
| InChIKey | ZVJHAIXPHQQQAZ-VXKWHMMOSA-N |
| XLogP | 3.24 |
| TPSA | 213.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|