C21H36N4O8 — CID 140567814
4-[[(2S)-1-[4-[[(2S)-2-[(2-carboxyacetyl)amino]-3-methylbutanoyl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 140567814) has the molecular formula C21H36N4O8 and a molecular weight of 472.54 g/mol. Its IUPAC name is 4-[[(2S)-1-[4-[[(2S)-2-[(2-carboxyacetyl)amino]-3-methylbutanoyl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2S)-1-[4-[[(2S)-2-[(2-carboxyacetyl)amino]-3-methylbutanoyl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 140567814 |
| Molecular Formula | C21H36N4O8 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 4-[[(2S)-1-[4-[[(2S)-2-[(2-carboxyacetyl)amino]-3-methylbutanoyl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCC(=O)O)C(=O)NCCCCNC(=O)[C@@H](NC(=O)CC(=O)O)C(C)C |
| InChI | InChI=1S/C21H36N4O8/c1-12(2)18(24-14(26)7-8-16(28)29)20(32)22-9-5-6-10-23-21(33)19(13(3)4)25-15(27)11-17(30)31/h12-13,18-19H,5-11H2,1-4H3,(H,22,32)(H,23,33)(H,24,26)(H,25,27)(H,28,29)(H,30,31)/t18-,19-/m0/s1 |
| InChIKey | XBDSTDCHABDRAB-OALUTQOASA-N |
| XLogP | -0.38 |
| TPSA | 191.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|