C18H31N3O5 — CID 167245096
4-[[6-[[3-methyl-1-oxo-1-(2-oxoethylamino)butan-2-yl]amino]-6-oxohexyl]amino]pent-4-enoic acid (PubChem CID 167245096) has the molecular formula C18H31N3O5 and a molecular weight of 369.46 g/mol. Its IUPAC name is 4-[[6-[[3-methyl-1-oxo-1-(2-oxoethylamino)butan-2-yl]amino]-6-oxohexyl]amino]pent-4-enoic acid.
| Compound Name | 4-[[6-[[3-methyl-1-oxo-1-(2-oxoethylamino)butan-2-yl]amino]-6-oxohexyl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 167245096 |
| Molecular Formula | C18H31N3O5 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 4-[[6-[[3-methyl-1-oxo-1-(2-oxoethylamino)butan-2-yl]amino]-6-oxohexyl]amino]pent-4-enoic acid |
| SMILES | C=C(CCC(=O)O)NCCCCCC(=O)NC(C(=O)NCC=O)C(C)C |
| InChI | InChI=1S/C18H31N3O5/c1-13(2)17(18(26)20-11-12-22)21-15(23)7-5-4-6-10-19-14(3)8-9-16(24)25/h12-13,17,19H,3-11H2,1-2H3,(H,20,26)(H,21,23)(H,24,25) |
| InChIKey | KBYDZRWOPVCIDJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|