C16H17NO3 — CID 132578233
(4R)-4-methyl-4-[(1S)-3-oxocyclohexyl]-2-phenyl-1,3-oxazol-5-one (PubChem CID 132578233) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is (4R)-4-methyl-4-[(1S)-3-oxocyclohexyl]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4R)-4-methyl-4-[(1S)-3-oxocyclohexyl]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 132578233 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (4R)-4-methyl-4-[(1S)-3-oxocyclohexyl]-2-phenyl-1,3-oxazol-5-one |
| SMILES | C[C@]1([C@H]2CCCC(=O)C2)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C16H17NO3/c1-16(12-8-5-9-13(18)10-12)15(19)20-14(17-16)11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3/t12-,16+/m0/s1 |
| InChIKey | OBRHBHPGYLGKIZ-BLLLJJGKSA-N |
| XLogP | 2.51 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |