C18H24OS2 — CID 135013509
3-(5-ethyl-2-phenyl-1,3-dithian-2-yl)cyclohexan-1-one (PubChem CID 135013509) has the molecular formula C18H24OS2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 3-(5-ethyl-2-phenyl-1,3-dithian-2-yl)cyclohexan-1-one.
| Compound Name | 3-(5-ethyl-2-phenyl-1,3-dithian-2-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 135013509 |
| Molecular Formula | C18H24OS2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-(5-ethyl-2-phenyl-1,3-dithian-2-yl)cyclohexan-1-one |
| SMILES | CCC1CSC(c2ccccc2)(C2CCCC(=O)C2)SC1 |
| InChI | InChI=1S/C18H24OS2/c1-2-14-12-20-18(21-13-14,15-7-4-3-5-8-15)16-9-6-10-17(19)11-16/h3-5,7-8,14,16H,2,6,9-13H2,1H3 |
| InChIKey | BPRDLGKSXFGYJV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |