C21H22N2S — CID 132578542
(6R)-6-(2-methylpropyl)-2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 132578542) has the molecular formula C21H22N2S and a molecular weight of 334.49 g/mol. Its IUPAC name is (6R)-6-(2-methylpropyl)-2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (6R)-6-(2-methylpropyl)-2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 132578542 |
| Molecular Formula | C21H22N2S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (6R)-6-(2-methylpropyl)-2,3-diphenyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole |
| SMILES | CC(C)C[C@@H]1CN2C(=N1)SC(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C21H22N2S/c1-15(2)13-18-14-23-19(16-9-5-3-6-10-16)20(24-21(23)22-18)17-11-7-4-8-12-17/h3-12,15,18H,13-14H2,1-2H3/t18-/m1/s1 |
| InChIKey | RATRWXQTMWKSPA-GOSISDBHSA-N |
| XLogP | 5.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|