2-(decanoylamino)ethyl hydrogen sulfate

C12H25NO5S — CID 13257981

IUPAC2-(decanoylamino)ethyl hydrogen sulfate
SMILESCCCCCCCCCC(=O)NCCOS(=O)(=O)O
InChIInChI=1S/C12H25NO5S/c1-2-3-4-5-6-7-8-9-12(14)13-10-11-18-19(15,16)17/h2-11H2,1H3,(H,13,14)(H,15,16,17)
InChIKeySUYHAWQPPOBPBG-UHFFFAOYSA-N
MW295.40 g/mol
LogP2.06
Rot. Bonds12

About 2-(decanoylamino)ethyl hydrogen sulfate

2-(decanoylamino)ethyl hydrogen sulfate (PubChem CID 13257981) has the molecular formula C12H25NO5S and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-(decanoylamino)ethyl hydrogen sulfate.

Molecular Properties

Compound Name2-(decanoylamino)ethyl hydrogen sulfate
PubChem CID13257981
Molecular FormulaC12H25NO5S
Molecular Weight295.40 g/mol
Exact Mass295.15
IUPAC Name2-(decanoylamino)ethyl hydrogen sulfate
SMILESCCCCCCCCCC(=O)NCCOS(=O)(=O)O
InChIInChI=1S/C12H25NO5S/c1-2-3-4-5-6-7-8-9-12(14)13-10-11-18-19(15,16)17/h2-11H2,1H3,(H,13,14)(H,15,16,17)
InChIKeySUYHAWQPPOBPBG-UHFFFAOYSA-N
XLogP2.06
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds12
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.40
LogP ≤ 52.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(decanoylamino)ethyl hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(decanoylamino)ethyl hydrogen sulfate?
The IUPAC name of 2-(decanoylamino)ethyl hydrogen sulfate (CID 13257981) is 2-(decanoylamino)ethyl hydrogen sulfate.
What is the SMILES notation for 2-(decanoylamino)ethyl hydrogen sulfate?
The canonical SMILES for 2-(decanoylamino)ethyl hydrogen sulfate is CCCCCCCCCC(=O)NCCOS(=O)(=O)O.
What is the InChIKey of 2-(decanoylamino)ethyl hydrogen sulfate?
The InChIKey is SUYHAWQPPOBPBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO5S/c1-2-3-4-5-6-7-8-9-12(14)13-10-11-18-19(15,16)17/h2-11H2,1H3,(H,13,14)(H,15,16,17).
What are the key properties of 2-(decanoylamino)ethyl hydrogen sulfate?
2-(decanoylamino)ethyl hydrogen sulfate has a molecular weight of 295.40 g/mol, XLogP of 2.06, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(decanoylamino)ethyl hydrogen sulfate is sourced from PubChem (CID 13257981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).