About 2-(decanoylamino)ethyl hydrogen sulfate
2-(decanoylamino)ethyl hydrogen sulfate (PubChem CID 13257981) has the molecular formula C12H25NO5S
and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-(decanoylamino)ethyl hydrogen sulfate.
Molecular Properties
| Compound Name | 2-(decanoylamino)ethyl hydrogen sulfate |
| PubChem CID | 13257981 |
| Molecular Formula | C12H25NO5S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-(decanoylamino)ethyl hydrogen sulfate |
| SMILES | CCCCCCCCCC(=O)NCCOS(=O)(=O)O |
| InChI | InChI=1S/C12H25NO5S/c1-2-3-4-5-6-7-8-9-12(14)13-10-11-18-19(15,16)17/h2-11H2,1H3,(H,13,14)(H,15,16,17) |
| InChIKey | SUYHAWQPPOBPBG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(decanoylamino)ethyl hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(decanoylamino)ethyl hydrogen sulfate?
The IUPAC name of 2-(decanoylamino)ethyl hydrogen sulfate (CID 13257981) is 2-(decanoylamino)ethyl hydrogen sulfate.
What is the SMILES notation for 2-(decanoylamino)ethyl hydrogen sulfate?
The canonical SMILES for 2-(decanoylamino)ethyl hydrogen sulfate is CCCCCCCCCC(=O)NCCOS(=O)(=O)O.
What is the InChIKey of 2-(decanoylamino)ethyl hydrogen sulfate?
The InChIKey is SUYHAWQPPOBPBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO5S/c1-2-3-4-5-6-7-8-9-12(14)13-10-11-18-19(15,16)17/h2-11H2,1H3,(H,13,14)(H,15,16,17).
What are the key properties of 2-(decanoylamino)ethyl hydrogen sulfate?
2-(decanoylamino)ethyl hydrogen sulfate has a molecular weight of 295.40 g/mol, XLogP of 2.06, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(decanoylamino)ethyl hydrogen sulfate is sourced from PubChem (CID 13257981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).