C37H43NO6 — CID 132580105
2-[(2S,3S,4S,5R,6S)-3-(benzylamino)-2-methoxy-4,5,6-tris(phenylmethoxy)oxepan-2-yl]ethanol (PubChem CID 132580105) has the molecular formula C37H43NO6 and a molecular weight of 597.75 g/mol. Its IUPAC name is 2-[(2S,3S,4S,5R,6S)-3-(benzylamino)-2-methoxy-4,5,6-tris(phenylmethoxy)oxepan-2-yl]ethanol.
| Compound Name | 2-[(2S,3S,4S,5R,6S)-3-(benzylamino)-2-methoxy-4,5,6-tris(phenylmethoxy)oxepan-2-yl]ethanol |
|---|---|
| PubChem CID | 132580105 |
| Molecular Formula | C37H43NO6 |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | 2-[(2S,3S,4S,5R,6S)-3-(benzylamino)-2-methoxy-4,5,6-tris(phenylmethoxy)oxepan-2-yl]ethanol |
| SMILES | CO[C@@]1(CCO)OC[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1NCc1ccccc1 |
| InChI | InChI=1S/C37H43NO6/c1-40-37(22-23-39)36(38-24-29-14-6-2-7-15-29)35(43-27-32-20-12-5-13-21-32)34(42-26-31-18-10-4-11-19-31)33(28-44-37)41-25-30-16-8-3-9-17-30/h2-21,33-36,38-39H,22-28H2,1H3/t33-,34-,35+,36-,37-/m0/s1 |
| InChIKey | ZFQLLBPYFPDMGB-GJOOVXBSSA-N |
| XLogP | 5.66 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |