C14H19NO7 — CID 132580487
dimethyl 2-[(1S,2R,8R)-2-methoxycarbonyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-1-yl]propanedioate (PubChem CID 132580487) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is dimethyl 2-[(1S,2R,8R)-2-methoxycarbonyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-1-yl]propanedioate.
| Compound Name | dimethyl 2-[(1S,2R,8R)-2-methoxycarbonyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-1-yl]propanedioate |
|---|---|
| PubChem CID | 132580487 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | dimethyl 2-[(1S,2R,8R)-2-methoxycarbonyl-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-1-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1[C@@H](C(=O)OC)C(=O)N2CCC[C@H]12 |
| InChI | InChI=1S/C14H19NO7/c1-20-12(17)9-8(7-5-4-6-15(7)11(9)16)10(13(18)21-2)14(19)22-3/h7-10H,4-6H2,1-3H3/t7-,8+,9-/m1/s1 |
| InChIKey | ZMDKPGYHGREXAI-HRDYMLBCSA-N |
| XLogP | -0.64 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|