C14H16N4 — CID 132581373
1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole (PubChem CID 132581373) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole.
| Compound Name | 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole |
|---|---|
| PubChem CID | 132581373 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole |
| SMILES | CC(C)C=C=Cc1nnnn1Cc1ccccc1 |
| InChI | InChI=1S/C14H16N4/c1-12(2)7-6-10-14-15-16-17-18(14)11-13-8-4-3-5-9-13/h3-5,7-10,12H,11H2,1-2H3 |
| InChIKey | WXGVEMNFBBPNBH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |