About 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole
1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole (PubChem CID 132581373) has the molecular formula C14H16N4
and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole.
Molecular Properties
| Compound Name | 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole |
| PubChem CID | 132581373 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole |
| SMILES | CC(C)C=C=Cc1nnnn1Cc1ccccc1 |
| InChI | InChI=1S/C14H16N4/c1-12(2)7-6-10-14-15-16-17-18(14)11-13-8-4-3-5-9-13/h3-5,7-10,12H,11H2,1-2H3 |
| InChIKey | WXGVEMNFBBPNBH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole?
The IUPAC name of 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole (CID 132581373) is 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole.
What is the SMILES notation for 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole?
The canonical SMILES for 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole is CC(C)C=C=Cc1nnnn1Cc1ccccc1.
What is the InChIKey of 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole?
The InChIKey is WXGVEMNFBBPNBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4/c1-12(2)7-6-10-14-15-16-17-18(14)11-13-8-4-3-5-9-13/h3-5,7-10,12H,11H2,1-2H3.
What are the key properties of 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole?
1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole has a molecular weight of 240.31 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5-(4-methylpenta-1,2-dienyl)tetrazole is sourced from PubChem (CID 132581373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).