C21H27FN5+ — CID 7140457
benzyl-ethyl-[(1R)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]azanium (PubChem CID 7140457) has the molecular formula C21H27FN5+ and a molecular weight of 368.48 g/mol. Its IUPAC name is benzyl-ethyl-[(1R)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]azanium.
| Compound Name | benzyl-ethyl-[(1R)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 7140457 |
| Molecular Formula | C21H27FN5+ |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | benzyl-ethyl-[(1R)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]azanium |
| SMILES | CC[NH+](Cc1ccccc1)[C@@H](c1nnnn1Cc1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C21H26FN5/c1-4-26(14-17-8-6-5-7-9-17)20(16(2)3)21-23-24-25-27(21)15-18-10-12-19(22)13-11-18/h5-13,16,20H,4,14-15H2,1-3H3/p+1/t20-/m1/s1 |
| InChIKey | BBVNHCGPLDMUDD-HXUWFJFHSA-O |
| XLogP | 2.66 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |