C12H9Br2NO — CID 132581866
3,5-dibromo-1-(4-methylphenyl)pyridin-2-one (PubChem CID 132581866) has the molecular formula C12H9Br2NO and a molecular weight of 343.02 g/mol. Its IUPAC name is 3,5-dibromo-1-(4-methylphenyl)pyridin-2-one.
| Compound Name | 3,5-dibromo-1-(4-methylphenyl)pyridin-2-one |
|---|---|
| PubChem CID | 132581866 |
| Molecular Formula | C12H9Br2NO |
| Molecular Weight | 343.02 g/mol |
| Exact Mass | 340.91 |
| IUPAC Name | 3,5-dibromo-1-(4-methylphenyl)pyridin-2-one |
| SMILES | Cc1ccc(-n2cc(Br)cc(Br)c2=O)cc1 |
| InChI | InChI=1S/C12H9Br2NO/c1-8-2-4-10(5-3-8)15-7-9(13)6-11(14)12(15)16/h2-7H,1H3 |
| InChIKey | ABNOBJIEKBOIGT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.02 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |